Simethicone (CAS 8050-81-5) <span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;"><span style="font-variant-ligatures: normal; orphans: 2; widows: 2;">is an oral anti-foaming agent used to reduce bloating, discomfort and pain caused by excess gas in the stomach or intestinal tract. Simethicone is a mixture of polydimethylsiloxane and hydrated silica gel.</span></span></span>
| Catalog Number | R057759 |
| CAS Number | 8050-81-5 |
| Synonyms | Aligest Plus; Antifoam A; DC Antifoam A; Dow Antifoam A; Dow Corning Antifoam A; Espumisan; KS 66; Mylicon; Q 7-2587; Sentry Simethicone GS; Silfoam SE 2; Simiticone; SonoRx; |
| Molecular Formula | C6H18O4Si3 |
| Purity | 95% |
| Storage | Store at +4C |
| IUPAC Name | dioxosilane;methoxy-dimethyl-trimethylsilyloxysilane |
| InChI | InChI=1S/C6H18O2Si2.O2Si/c1-7-10(5,6)8-9(2,3)4;1-3-2/h1-6H3; |
| InChIKey | AMTWCFIAVKBGOD-UHFFFAOYSA-N |
| SMILES | CO[Si](C)(C)O[Si](C)(C)C.O=[Si]=O |
| Reference | <span style="font-size:12px;">1.<span style="font-family: Arial, sans-serif; font-variant-ligatures: normal; orphans: 2; widows: 2;">Grinshpan, D. D., et al. <span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;">"Comparison of acid-neutralizing properties of anti-acid preparations of various compositions." </span></span></span><span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"><i style="font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;">Pharmaceutical Chemistry Journal</i></span></span><span style="font-family: Arial, sans-serif; font-variant-ligatures: normal; orphans: 2; widows: 2;"><span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"> 42.7 (2008): 400-404.</span></span><br /> |
