For research use only. Not for therapeutic Use.
Simazine（Cat No.:R052961）is a triazine herbicide widely applied for pre- and post-emergence control of broadleaf weeds and grasses. It functions by inhibiting photosystem II, blocking electron transport during photosynthesis and leading to growth suppression in susceptible plants. Due to its stability and effectiveness, simazine is commonly used in agriculture for crops such as corn, fruit orchards, and vineyards, as well as in non-crop areas for long-term weed management. Additionally, simazine serves as a research tool in plant biology, environmental toxicology, and herbicide resistance studies.
| CAS Number | 122-34-9 |
| Synonyms | 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
| Molecular Formula | C7H12ClN5 |
| Purity | ≥95% |
| IUPAC Name | 6-chloro-2-N,4-N-diethyl-1,3,5-triazine-2,4-diamine |
| InChI | InChI=1S/C7H12ClN5/c1-3-9-6-11-5(8)12-7(13-6)10-4-2/h3-4H2,1-2H3,(H2,9,10,11,12,13) |
| InChIKey | ODCWYMIRDDJXKW-UHFFFAOYSA-N |
| SMILES | CCNC1=NC(=NC(=N1)Cl)NCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
