For research use only. Not for therapeutic Use.
Silymarin (>80%)(Cat No.:R021655)is a standardized extract derived from the seeds of Silybum marianum (milk thistle), containing primarily silybin, the active component known for its potent antioxidant and hepatoprotective properties. This high-quality extract is widely utilized in pharmaceutical and nutraceutical research for its role in supporting liver health, detoxification, and combating oxidative stress. Silymarin’s ability to protect liver cells from toxins and aid in the regeneration of damaged liver tissue makes it valuable in the treatment of liver diseases such as cirrhosis and hepatitis.
| CAS Number | 65666-07-1 |
| Synonyms | Apihepar; Darsil; Flavobion; Karsilin; Laragon; Legalon; Legalon 70; Pluropon; Silarin; Silepar; Silirex; Silistrong; Silmar; Silymarin Group; Silystrong? |
| Molecular Formula | C25H22O10 |
| Purity | ≥95% |
| Target | SARS-CoV |
| Storage | 3 years -20C powder |
| IUPAC Name | 3,5,7-trihydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C25H22O10/c1-32-17-6-11(2-4-14(17)28)24-20(10-26)33-16-5-3-12(7-18(16)34-24)25-23(31)22(30)21-15(29)8-13(27)9-19(21)35-25/h2-9,20,23-29,31H,10H2,1H3 |
| InChIKey | SEBFKMXJBCUCAI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2C(OC3=C(O2)C=C(C=C3)C4C(C(=O)C5=C(C=C(C=C5O4)O)O)O)CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |