For research use only. Not for therapeutic Use.
Sibrafiban(Cat No.:M043965)is an oral glycoprotein IIb/IIIa receptor antagonist developed to prevent blood clots in patients with acute coronary syndromes or undergoing certain heart procedures. By inhibiting platelet aggregation, Sibrafiban reduces the risk of thrombotic events such as heart attacks and strokes. It offers an alternative to intravenous anticoagulants, providing the convenience of oral administration. Despite promising initial results, further clinical trials were halted due to concerns about its efficacy and safety compared to existing treatments. Sibrafiban remains a significant step in the development of oral antiplatelet therapies.
| CAS Number | 172927-65-0 |
| Molecular Formula | C20H28N4O6 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-[1-[(2S)-2-[[4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl]amino]propanoyl]piperidin-4-yl]oxyacetate |
| InChI | InChI=1S/C20H28N4O6/c1-3-29-17(25)12-30-16-8-10-24(11-9-16)20(27)13(2)22-19(26)15-6-4-14(5-7-15)18(21)23-28/h4-7,13,16,28H,3,8-12H2,1-2H3,(H2,21,23)(H,22,26)/t13-/m0/s1 |
| InChIKey | WBNUCLPUOSXSNJ-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)COC1CCN(CC1)C(=O)C(C)NC(=O)C2=CC=C(C=C2)C(=NO)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |