For research use only. Not for therapeutic Use.
SIB-1757（Cat No.:I009352）is a selective small molecule inhibitor that targets the protein kinase CK1α (Casein Kinase 1 alpha), which plays a crucial role in regulating various cellular processes, including cell cycle progression, DNA repair, and circadian rhythm. By inhibiting CK1α, SIB-1757 disrupts these essential pathways, making it a promising therapeutic agent in cancer research, particularly for tumors where CK1α is overexpressed. Additionally, SIB-1757 has shown potential in targeting circadian rhythm-related disorders, neurodegenerative diseases, and other conditions influenced by CK1α activity, offering a novel approach for therapeutic intervention.
| CAS Number | 31993-01-8 |
| Synonyms | 6-methyl-2-phenyldiazenylpyridin-3-ol |
| Molecular Formula | C12H11N3O |
| Purity | ≥95% |
| IUPAC Name | 6-methyl-2-phenyldiazenylpyridin-3-ol |
| InChI | InChI=1S/C12H11N3O/c1-9-7-8-11(16)12(13-9)15-14-10-5-3-2-4-6-10/h2-8,16H,1H3 |
| InChIKey | LOCPVWIREQIGNQ-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(C=C1)O)N=NC2=CC=CC=C2 |
| Reference |
|
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
