For research use only. Not for therapeutic Use.
SIB-1553A(CAT: R062192) is an orally bioavailable, selective nicotinic acetylcholine receptor (nAChR) agonist with preference for β4 subunit–containing receptors, including α2β4, α3β4, and α4β4 subtypes. It displaces [³H]nicotine binding to rat brain nAChRs with an IC₅₀ of 110 nM and demonstrates significantly greater efficacy and potency at β4-containing receptors compared to β2-containing nAChRs. In vivo, subcutaneous administration (1–40 mg/kg) produces dose-dependent increases in acetylcholine levels. As a neuronal nAChR ligand and cognitive enhancer, SIB-1553A has therapeutic potential for Alzheimer’s disease and other cognitive disorders, making it a valuable tool for neuropharmacology, memory research, and drug discovery in neurodegeneration.
| CAS Number | 191611-89-9 |
| Synonyms | 4-[2-(1-methylpyrrolidin-2-yl)ethylsulfanyl]phenol;hydrochloride |
| Molecular Formula | C13H20ClNOS |
| Purity | ≥95% |
| IUPAC Name | 4-[2-(1-methylpyrrolidin-2-yl)ethylsulfanyl]phenol;hydrochloride |
| InChI | InChI=1S/C13H19NOS.ClH/c1-14-9-2-3-11(14)8-10-16-13-6-4-12(15)5-7-13;/h4-7,11,15H,2-3,8-10H2,1H3;1H |
| InChIKey | RJSVKPQKXSMZMT-UHFFFAOYSA-N |
| SMILES | CN1CCCC1CCSC2=CC=C(C=C2)O.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
