For research use only. Not for therapeutic Use.
Sesamol（Cat No.:R058333）, is a natural phenolic compound found in sesame seeds and sesame oil. It possesses antioxidant properties, helping to combat oxidative stress by scavenging free radicals. Sesamol has been studied for its potential health benefits, including anti-inflammatory, anticancer, and cardiovascular protective effects. It also finds applications as a natural antioxidant and preservative in the food and cosmetic industries. Ongoing research explores its diverse applications and therapeutic potential in various fields.
| Catalog Number | R058333 |
| CAS Number | 533-31-3 |
| Synonyms | 1,3-Benzodioxol-5-ol; 3,4-(Methylenedioxy)phenol; 4-Hydroxy-1,2-methylenedioxybenzene; 5-Hydroxy-1,3-benzodioxole; NSC 59256; |
| Molecular Formula | C7H6O3 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | RT |
| IUPAC Name | 1,3-benzodioxol-5-ol |
| InChI | InChI=1S/C7H6O3/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3,8H,4H2 |
| InChIKey | LUSZGTFNYDARNI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)O |
