For research use only. Not for therapeutic Use.
Seneganolide(CAT: R020173) is a naturally occurring triterpenoid saponin isolated from Polygala senega and related species traditionally used in herbal medicine. Structurally complex, Seneganolide features a polycyclic triterpene core with sugar moieties, contributing to its amphipathic properties and bioactivity. It is known for its expectorant, anti-inflammatory, and antimicrobial effects, making it a key active component in traditional remedies for respiratory conditions such as bronchitis and asthma. Seneganolide is also studied for its potential in immune modulation and neuroprotection. Its multifaceted pharmacological profile makes it a valuable compound for natural product research, phytochemistry, and therapeutic development.
| CAS Number | 301530-12-1 |
| Synonyms | (1S,2R,6R,7R,10R,11S,16S,19S,20S)-6-(furan-3-yl)-20-hydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14,18-trione |
| Molecular Formula | C26H30O8 |
| Purity | ≥95% |
| IUPAC Name | (1S,2R,6R,7R,10R,11S,16S,19S,20S)-6-(furan-3-yl)-20-hydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14,18-trione |
| InChI | InChI=1S/C26H30O8/c1-22(2)16-8-18(27)32-12-24(16)15-4-6-23(3)17(9-19(28)33-21(23)13-5-7-31-11-13)25(15)10-14(20(22)29)26(24,30)34-25/h5,7,11,14-17,21,30H,4,6,8-10,12H2,1-3H3/t14-,15+,16-,17+,21-,23+,24+,25+,26-/m0/s1 |
| InChIKey | VIOKSDWKSSMHBF-MQELVVIJSA-N |
| SMILES | C[C@@]12CC[C@H]3[C@@]4([C@@H]1CC(=O)O[C@H]2C5=COC=C5)C[C@H]6C(=O)C([C@H]7[C@@]3([C@]6(O4)O)COC(=O)C7)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
