For research use only. Not for therapeutic Use.
Seltorexant Hydrochloride(CAT: I017252) is a potent and selective antagonist of the orexin-2 receptor (OX2R), widely studied for its role in modulating sleep-wake cycles and mood regulation. By selectively targeting OX2R, it promotes sleep onset and maintenance, making it a valuable compound for research into insomnia and other sleep disorders. Additionally, Seltorexant Hydrochloride has shown potential in investigating the treatment of depression, anxiety, and stress-related disorders. Its high specificity and efficacy make it a critical tool in neuropharmacological studies and the development of novel therapeutics targeting orexin-related pathways.
CAS Number | 1293284-49-7 |
Molecular Formula | C₂₁H₂₃ClFN₇O |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | [2-(4,6-dimethylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-(triazol-2-yl)phenyl]methanone;hydrochloride |
InChI | InChI=1S/C21H22FN7O.ClH/c1-13-8-14(2)26-21(25-13)28-11-15-9-27(10-16(15)12-28)20(30)19-17(22)4-3-5-18(19)29-23-6-7-24-29;/h3-8,15-16H,9-12H2,1-2H3;1H |
InChIKey | LILZQJZQERNISU-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC(=N1)N2CC3CN(CC3C2)C(=O)C4=C(C=CC=C4F)N5N=CC=N5)C.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |