For research use only. Not for therapeutic Use.
Selank(Cat No.:P000346)is a synthetic peptide, derived from the naturally occurring peptide tuftsin, which has neuroprotective, anxiolytic, and cognitive-enhancing properties. It consists of seven amino acids and is known for its ability to modulate the activity of neurotransmitters like serotonin and dopamine, promoting neurogenesis and enhancing memory and learning. Selank is often used in research related to anxiety, stress, and cognitive disorders, with potential applications in treating anxiety disorders, improving mood, and enhancing cognitive performance. It is typically administered intranasally and is being studied for its safety and efficacy in clinical settings.
| CAS Number | 129954-34-3 |
| Synonyms | L-Threonyl-L-lysyl-L-prolyl-L-arginyl-L-prolylglycyl-L-proline |
| Molecular Formula | C33 H57 N11 O9 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2S)-1-[2-[[(2S)-1-[(2S)-2-[[(2S)-1-[(2S)-6-amino-2-[[(2S,3R)-2-amino-3-hydroxybutanoyl]amino]hexanoyl]pyrrolidine-2-carbonyl]amino]-5-(diaminomethylideneamino)pentanoyl]pyrrolidine-2-carbonyl]amino]acetyl]pyrrolidine-2-carboxylic acid |
| InChI | InChI=1S/C33H57N11O9/c1-19(45)26(35)29(49)41-20(8-2-3-13-34)30(50)44-17-6-11-23(44)28(48)40-21(9-4-14-38-33(36)37)31(51)43-16-5-10-22(43)27(47)39-18-25(46)42-15-7-12-24(42)32(52)53/h19-24,26,45H,2-18,34-35H2,1H3,(H,39,47)(H,40,48)(H,41,49)(H,52,53)(H4,36,37,38)/t19-,20+,21+,22+,23+,24+,26+/m1/s1 |
| InChIKey | JTDTXGMXNXBGBZ-YVHUGQOKSA-N |
| SMILES | C[C@H]([C@@H](C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CCCN=C(N)N)C(=O)N2CCC[C@H]2C(=O)NCC(=O)N3CCC[C@H]3C(=O)O)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |