For research use only. Not for therapeutic Use.
Segetalin A（Cat No.:R013460）is a natural product derived from the fungus Penicillium segetale, known for its potent bioactive properties. It exhibits strong antifungal and antimicrobial activity, making it valuable in the development of novel therapeutic agents. Segetalin A works by disrupting cell membrane integrity in various pathogens, inhibiting their growth and proliferation. This compound has shown promise in preclinical studies for treating infections caused by resistant microbial strains. Additionally, its unique structure and activity profile make Segetalin A a potential lead compound for exploring new classes of antifungal and antibacterial drugs.
| CAS Number | 161875-97-4 |
| Synonyms | (3S,9S,12S,15S,18S)-12-(1H-indol-3-ylmethyl)-9-methyl-3,15-di(propan-2-yl)-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosane-2,5,8,11,14,17-hexone |
| Molecular Formula | C31H43N7O6 |
| Purity | ≥95% |
| IUPAC Name | (3S,9S,12S,15S,18S)-12-(1H-indol-3-ylmethyl)-9-methyl-3,15-di(propan-2-yl)-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosane-2,5,8,11,14,17-hexone |
| InChI | InChI=1S/C31H43N7O6/c1-16(2)25-30(43)35-22(13-19-14-32-21-10-7-6-9-20(19)21)28(41)34-18(5)27(40)33-15-24(39)36-26(17(3)4)31(44)38-12-8-11-23(38)29(42)37-25/h6-7,9-10,14,16-18,22-23,25-26,32H,8,11-13,15H2,1-5H3,(H,33,40)(H,34,41)(H,35,43)(H,36,39)(H,37,42)/t18-,22-,23-,25-,26-/m0/s1 |
| InChIKey | YVUZOKYOUUCVBV-WJTDBPPMSA-N |
| SMILES | C[C@H]1C(=O)NCC(=O)N[C@H](C(=O)N2CCC[C@H]2C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)CC3=CNC4=CC=CC=C43)C(C)C)C(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
