For research use only. Not for therapeutic Use.
Se-Methylseleno-L-cysteine hydrochloride(Cat No.:M144147) is a selenium-containing compound. It is a derivative of the amino acid L-cysteine, where a methylseleno group (-SeCH3) replaces the sulfur atom in the cysteine molecule. This compound is a source of organic selenium, a trace element with antioxidant properties and potential health benefits. Se-Methylseleno-L-cysteine is being studied for its potential in cancer prevention and therapy, as selenium is believed to play a role in reducing oxidative stress and inflammation, as well as in regulating cell growth and apoptosis.
CAS Number | 863394-07-4 |
Molecular Formula | C4H10ClNO2Se |
Purity | ≥95% |
Target | Neuronal Signaling |
Storage | -20°C |
IUPAC Name | (2R)-2-amino-3-methylselanylpropanoic acid;hydrochloride |
InChI | InChI=1S/C4H9NO2Se.ClH/c1-8-2-3(5)4(6)7;/h3H,2,5H2,1H3,(H,6,7);1H/t3-;/m0./s1 |
InChIKey | JMPVTFHGWJDSDV-DFWYDOINSA-N |
SMILES | C[Se]CC(C(=O)O)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |