For research use only. Not for therapeutic Use.
Scopoline（Cat No.:I043734）is a naturally occurring alkaloid found in plants like Scopolia species, known for its pharmacological effects on the central nervous system. It is structurally related to other tropane alkaloids, such as scopolamine, and functions as a muscarinic acetylcholine receptor antagonist. Scopoline has been studied for its potential anticholinergic properties, which may offer therapeutic benefits in conditions like motion sickness, Parkinson’s disease, and other disorders related to acetylcholine dysfunction. While its primary use is still under investigation, scopoline’s ability to modulate neurotransmitter systems presents promising avenues for drug development.
| CAS Number | 487-27-4 |
| Synonyms | (1S,3S,4S,5S,7R)-6-methyl-2-oxa-6-azatricyclo[3.3.1.03,7]nonan-4-ol |
| Molecular Formula | C8H13NO2 |
| Purity | ≥95% |
| IUPAC Name | (1S,3S,4S,5S,7R)-6-methyl-2-oxa-6-azatricyclo[3.3.1.03,7]nonan-4-ol |
| InChI | InChI=1S/C8H13NO2/c1-9-5-2-4-3-6(9)8(11-4)7(5)10/h4-8,10H,2-3H2,1H3/t4-,5-,6+,7-,8-/m0/s1 |
| InChIKey | MEGPURSNXMUDAE-RLMOJYMMSA-N |
| SMILES | CN1[C@H]2C[C@H]3C[C@@H]1[C@@H]([C@H]2O)O3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
