For research use only. Not for therapeutic Use.
Scopolamine (Cat No.: I005511) is a compound that can be extracted from plants like Artemisia annua, which holds significant medicinal and agricultural importance. Beyond its well-known medicinal applications as a medication to alleviate nausea and motion sickness, it exhibits various agricultural biological activities. These include insecticidal and acaricidal properties, antibacterial effects, regulation of plant growth and development, and the ability to induce plant resistance against pathogens. This multifaceted compound underscores its potential value not only in human medicine but also in agriculture, where it can contribute to pest control and crop protection.
CAS Number | 92-61-5 |
Synonyms | Esculetin 6-methyl ether;NSC 405647 |
Molecular Formula | C10H8O4 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO ≥ 32 mg/mL |
Storage | 2-8°C |
IC50 | 0.06 μM |
IUPAC Name | 7-hydroxy-6-methoxychromen-2-one |
InChI | InChI=1S/C10H8O4/c1-13-9-4-6-2-3-10(12)14-8(6)5-7(9)11/h2-5,11H,1H3 |
InChIKey | RODXRVNMMDRFIK-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C(=C1)C=CC(=O)O2)O |
Reference | <p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |