For research use only. Not for therapeutic Use.
Schisandrin B (Cat.No:I004312) is a natural compound found in Schisandra chinensis, a traditional Chinese medicinal plant. It is known for its pharmacological properties, including antioxidant, anti-inflammatory, and hepatoprotective effects. Schisandrin B has been studied for its potential therapeutic applications in liver diseases, neuroprotection, and anti-aging interventions.
CAS Number | 61281-37-6 |
Molecular Formula | C23H28O6 |
Purity | ≥95% |
Target | NF-κB |
Solubility | 10 mM in DMSO |
Storage | 3 years -20℃ powder |
IUPAC Name | 3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene |
InChI | InChI=1S/C23H28O6/c1-12-7-14-9-16(24-3)20(25-4)22(26-5)18(14)19-15(8-13(12)2)10-17-21(23(19)27-6)29-11-28-17/h9-10,12-13H,7-8,11H2,1-6H3 |
InChIKey | RTZKSTLPRTWFEV-UHFFFAOYSA-N |
SMILES | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4CC1C)OC)OC)OC)OC)OCO3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |