For research use only. Not for therapeutic Use.
SC144 Hydrochloride(CAT: I005470) is a potent, selective inhibitor of the Rho-associated coiled-coil kinase 2 (ROCK2), crucial for regulating various cellular processes, including cell migration, contraction, and survival. Its selective inhibition of ROCK2 has therapeutic potential in treating fibrosis, cancer metastasis, and other diseases associated with aberrant cell motility. By targeting the ROCK2 pathway, SC144 Hydrochloride holds promise in advancing therapeutic strategies aimed at regulating cell movement and tissue remodeling in a variety of pathophysiological conditions.
| CAS Number | 917497-70-2 |
| Synonyms | SC-144 hydrochloride |
| Molecular Formula | C16H12ClFN6O |
| Purity | ≥95% |
| Target | Apoptosis |
| Solubility | DMSO 5 mg/ml warmed |
| Storage | Store at -20°C |
| IC50 | < 1 uM (Cell assay) |
| IUPAC Name | N'-(7-fluoropyrrolo[1,2-a]quinoxalin-4-yl)pyrazine-2-carbohydrazide;hydrochloride |
| InChI | 1S/C16H11FN6O.ClH/c17-10-3-4-13-11(8-10)20-15(14-2-1-7-23(13)14)21-22-16(24)12-9-18-5-6-19-12;/h1-9H,(H,20,21)(H,22,24);1H |
| InChIKey | LKFGGXYXFIICED-UHFFFAOYSA-N |
| SMILES | C1=CN2C3=C(C=C(C=C3)F)N=C(C2=C1)NNC(=O)C4=NC=CN=C4.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |