For research use only. Not for therapeutic Use.
SB-435495(Cat No.:I041267)is a selective, potent inhibitor of the S1P1 (Sphingosine-1-phosphate receptor 1) receptor, which is involved in immune cell trafficking and vascular endothelial function. By targeting S1P1, SB-435495 modulates immune responses and can influence processes such as inflammation and lymphocyte migration. This compound has been explored in preclinical studies for its potential to treat autoimmune diseases, such as multiple sclerosis, by reducing the migration of immune cells to sites of inflammation. SB-435495’s ability to selectively block S1P1 makes it a promising candidate for targeted immunomodulatory therapies.
| CAS Number | 304694-39-1 |
| Synonyms | N-[2-(diethylamino)ethyl]-2-[2-[(4-fluorophenyl)methylsulfanyl]-5-[(1-methylpyrazol-4-yl)methyl]-4-oxopyrimidin-1-yl]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide |
| Molecular Formula | C38H40F4N6O2S |
| Purity | ≥95% |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-[2-[(4-fluorophenyl)methylsulfanyl]-5-[(1-methylpyrazol-4-yl)methyl]-4-oxopyrimidin-1-yl]-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]acetamide |
| InChI | InChI=1S/C38H40F4N6O2S/c1-4-46(5-2)18-19-47(23-27-6-10-30(11-7-27)31-12-14-33(15-13-31)38(40,41)42)35(49)25-48-24-32(20-29-21-43-45(3)22-29)36(50)44-37(48)51-26-28-8-16-34(39)17-9-28/h6-17,21-22,24H,4-5,18-20,23,25-26H2,1-3H3 |
| InChIKey | VGIQUSQBXZXBGW-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN(CC1=CC=C(C=C1)C2=CC=C(C=C2)C(F)(F)F)C(=O)CN3C=C(C(=O)N=C3SCC4=CC=C(C=C4)F)CC5=CN(N=C5)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |