For research use only. Not for therapeutic Use.
SB 200646 hydrochloride(Cat No.:I010402)is a selective inhibitor of the enzyme soluble guanylate cyclase (sGC), which plays a crucial role in the nitric oxide signaling pathway. By inhibiting sGC, SB 200646 hydrochloride can modulate the production of cyclic GMP (cGMP), a secondary messenger involved in various physiological processes, including vasodilation and smooth muscle relaxation. This compound has been studied for its potential therapeutic applications in cardiovascular diseases, such as hypertension and heart failure, where modulation of nitric oxide signaling can improve blood flow and reduce strain on the heart.
CAS Number | 143797-62-0 |
Synonyms | N-(1-Methyl-1H-indol-5-yl)-N/’-3-pyridinylurea |
Molecular Formula | C15H15ClN4O |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | Soluble to 100 mM in DMSO |
Storage | Store at RT |
IUPAC Name | 1-(1-methylindol-5-yl)-3-pyridin-3-ylurea;hydrochloride |
InChI | InChI=1S/C15H14N4O.ClH/c1-19-8-6-11-9-12(4-5-14(11)19)17-15(20)18-13-3-2-7-16-10-13;/h2-10H,1H3,(H2,17,18,20);1H |
InChIKey | IGRYPUQJEDJLHC-UHFFFAOYSA-N |
SMILES | CN1C=CC2=C1C=CC(=C2)NC(=O)NC3=CN=CC=C3.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |