For research use only. Not for therapeutic Use.
SARS-CoV-2-IN-7（Cat No.:I045232）is a small-molecule inhibitor designed to target and suppress key enzymatic functions essential for SARS-CoV-2 replication. By interfering with viral proteases or other replication-associated proteins, it disrupts the viral life cycle, reducing the ability of the virus to proliferate within host cells. This compound is valuable for antiviral research, particularly in exploring therapeutic strategies against COVID-19 and related coronaviruses. Its specificity and potency make it a useful tool for studying viral pathogenesis, drug-resistance mechanisms, and the development of next-generation antiviral agents in infectious disease research.
| CAS Number | 2570461-66-2 |
| Synonyms | 2-[3-(trifluoromethyl)phenyl]-1,2-benzoselenazol-3-one |
| Molecular Formula | C14H8F3NOSe |
| Purity | ≥95% |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-1,2-benzoselenazol-3-one |
| InChI | InChI=1S/C14H8F3NOSe/c15-14(16,17)9-4-3-5-10(8-9)18-13(19)11-6-1-2-7-12(11)20-18/h1-8H |
| InChIKey | AUNYFNONXIUSKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N([Se]2)C3=CC=CC(=C3)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
