For research use only. Not for therapeutic Use.
SARS-CoV-2-IN-14（Cat No.:I043706）is a selective inhibitor targeting the main protease (Mpro) of the SARS-CoV-2 virus, responsible for catalyzing the cleavage of viral polyproteins during replication. By inhibiting Mpro, SARS-CoV-2-IN-14 disrupts viral replication, potentially reducing viral load and the severity of infection. This compound has gained attention in the search for effective antiviral agents against COVID-19. Its mechanism of action may provide a therapeutic avenue for treating SARS-CoV-2 infections, either as a standalone treatment or in combination with other antiviral therapies to combat the ongoing pandemic.
| CAS Number | 22203-98-1 |
| Synonyms | 5-chloro-N-(3-chlorophenyl)-2-hydroxybenzamide |
| Molecular Formula | C13H9Cl2NO2 |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-N-(3-chlorophenyl)-2-hydroxybenzamide |
| InChI | InChI=1S/C13H9Cl2NO2/c14-8-2-1-3-10(6-8)16-13(18)11-7-9(15)4-5-12(11)17/h1-7,17H,(H,16,18) |
| InChIKey | NXDGLRGDIKDWIF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NC(=O)C2=C(C=CC(=C2)Cl)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
