For research use only. Not for therapeutic Use.
SARS-CoV-2-IN-13（Cat No.:I043707）is a selective small molecule inhibitor designed to target the SARS-CoV-2 virus, specifically inhibiting its replication and entry into host cells. By blocking key viral enzymes or proteins involved in the virus’s lifecycle, such as the spike protein or proteases, SARS-CoV-2-IN-13 reduces viral load and prevents further infection. This compound shows promise in treating COVID-19, potentially providing an alternative to existing therapies. SARS-CoV-2-IN-13 represents a novel approach to managing the ongoing pandemic, targeting viral mechanisms to reduce disease progression and transmission.
| CAS Number | 56961-10-5 |
| Synonyms | 5-chloro-N-(3-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| Molecular Formula | C13H8Cl2N2O4 |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-N-(3-chloro-4-nitrophenyl)-2-hydroxybenzamide |
| InChI | InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-8-2-3-11(17(20)21)10(15)6-8/h1-6,18H,(H,16,19) |
| InChIKey | FKLGWJUBUPDJJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)C2=C(C=CC(=C2)Cl)O)Cl)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
