For research use only. Not for therapeutic Use.
Sarracenin(CAT: R072709) is a naturally occurring monoterpenoid compound first identified in species of the carnivorous plant genus Sarracenia. Structurally related to iridoid-type metabolites, Sarracenin contributes to the plant’s chemical defense and ecological interactions. It exhibits notable antimicrobial and cytotoxic activities, making it a compound of interest in natural products research and pharmacology. Due to its unique structure, Sarracenin serves as a useful scaffold for studying plant secondary metabolism and potential therapeutic applications. Its biological activity profile highlights its potential role in drug discovery, antimicrobial development, and ecological biochemistry, where natural terpenoids are increasingly explored as bioactive small molecules.
| CAS Number | 59653-37-1 |
| Synonyms | methyl (1R,3R,7S,8S,9S)-9-methyl-2,4,10-trioxatricyclo[5.3.1.03,8]undec-5-ene-6-carboxylate |
| Molecular Formula | C11H14O5 |
| Purity | ≥95% |
| IUPAC Name | methyl (1R,3R,7S,8S,9S)-9-methyl-2,4,10-trioxatricyclo[5.3.1.03,8]undec-5-ene-6-carboxylate |
| InChI | InChI=1S/C11H14O5/c1-5-9-6-3-8(15-5)16-11(9)14-4-7(6)10(12)13-2/h4-6,8-9,11H,3H2,1-2H3/t5-,6+,8+,9+,11+/m0/s1 |
| InChIKey | QGBCGMGBGAHJIT-DANLAGSESA-N |
| SMILES | CC1C2C3CC(O1)OC2OC=C3C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
