Sarecycline(CAT: I009292), also known as WC-3035 and P005672, is a novel, tetracycline-derived, narrow-spectrum antibiotic being developed for use as an antibiotic treatment for patients suffering from moderate to severe acne vulgaris. Sarecycline was designed by Paratek as a narrow-spectrum antibiotic with anti-inflammatory activity and the potential for a favorable tolerability profile.
| Catalog Number | I009292 |
| CAS Number | 1035979-44-2 (HCl); 1035654-66-0 (frtee base) |
| Synonyms | P005672; P-005672; P 005672; P005672 HCl; Sarecycline hydrochloride;(4S,4aS,5aR,12aS)-4-(dimethylamino)-3,10,12,12a-tetrahydroxy-7-((methoxy(methyl)amino)methyl)-1,11-dioxo-1,4,4a,5,5a,6,11,12a-octahydrotetracene-2-carboxamide hydrochloride |
| Molecular Formula | C24H30ClN3O8 |
| Purity | 95% |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4 °C for short term, or -20 °C for long term |
| SMILES | O=C(C1=C(O)[C@@H](N(C)C)[C@@](C[C@@]2([H])C(C(C3=C(O)C=CC(CN(OC)C)=C3C2)=O)=C4O)([H])[C@@]4(O)C1=O)N.[H]Cl |
| Reference | <br /> |
