For research use only. Not for therapeutic Use.
Sappanchalcone (Cat.No:R058093) is a natural compound derived from Caesalpinia sappan, a medicinal plant. Known for its antioxidant, anti-inflammatory, and anticancer properties, sappanchalcone has attracted attention in traditional medicine and modern research. It shows potential as a therapeutic agent in various health conditions and continues to be studied for its pharmacological activities.
| CAS Number | 94344-54-4 |
| Synonyms | (2E)-3-(3,4-Dihydroxyphenyl)-1-(4-hydroxy-2-methoxyphenyl)-2-propen-1-one |
| Molecular Formula | C16H14O5 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-1-(4-hydroxy-2-methoxyphenyl)prop-2-en-1-one |
| InChI | InChI=1S/C16H14O5/c1-21-16-9-11(17)4-5-12(16)13(18)6-2-10-3-7-14(19)15(20)8-10/h2-9,17,19-20H,1H3/b6-2+ |
| InChIKey | JVGNTXGHBHMJDO-QHHAFSJGSA-N |
| SMILES | COC1=C(C=CC(=C1)O)C(=O)C=CC2=CC(=C(C=C2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |