For research use only. Not for therapeutic Use.
Salviaflaside(CAT: M038737) is a phenolic glycoside compound originally identified in species of the Salvia genus. Structurally, it consists of a caffeic acid ester linked to a sugar moiety, which contributes to its solubility and biological activity. As part of the phenylpropanoid glycoside family, salviaflaside has been studied for its antioxidant, anti-inflammatory, and antimicrobial properties. It plays a role in protecting plants against oxidative stress and pathogen attack, while in pharmacological research it has been investigated for potential therapeutic benefits in inflammation-related and oxidative stress–associated disorders. Salviaflaside is also used as a phytochemical marker in quality control of Salvia-based herbal preparations.
| CAS Number | 178895-25-5 |
| Synonyms | (2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxypropanoic acid |
| Molecular Formula | C24H26O13 |
| Purity | ≥95% |
| IUPAC Name | (2R)-3-(3,4-dihydroxyphenyl)-2-[(E)-3-[4-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxypropanoic acid |
| InChI | InChI=1S/C24H26O13/c25-10-18-20(30)21(31)22(32)24(37-18)36-16-8-11(1-5-14(16)27)3-6-19(29)35-17(23(33)34)9-12-2-4-13(26)15(28)7-12/h1-8,17-18,20-22,24-28,30-32H,9-10H2,(H,33,34)/b6-3+/t17-,18-,20-,21+,22-,24-/m1/s1 |
| InChIKey | DSMWJDJWYGMEBO-PRFRQLEPSA-N |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)OC(=O)C=CC2=CC(=C(C=C2)O)OC3C(C(C(C(O3)CO)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
