For research use only. Not for therapeutic Use.
S6K1-IN-DG2(CAT: I035894) is an inhibitor targeting S6 kinase 1 (S6K1), a key protein kinase involved in the mTOR (mechanistic target of rapamycin) signaling pathway. S6K1 plays a crucial role in cell growth, protein synthesis, and metabolism by phosphorylating ribosomal protein S6 and other targets. Dysregulation of S6K1 is implicated in various diseases, including cancer, metabolic disorders, and neurological conditions. By inhibiting S6K1, S6K1-IN-DG2 disrupts these cellular processes, offering potential therapeutic benefits. This compound is particularly relevant for Cancer Disease Research and Metabolic Disease Research, as it could provide a novel strategy for targeting aberrant cell growth and metabolic dysfunctions.
CAS Number | 871340-88-4 |
Synonyms | 3-bromo-4-[4-(2-methoxyphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidine |
Molecular Formula | C16H17BrN6O |
Purity | ≥95% |
IUPAC Name | 3-bromo-4-[4-(2-methoxyphenyl)piperazin-1-yl]-2H-pyrazolo[3,4-d]pyrimidine |
InChI | InChI=1S/C16H17BrN6O/c1-24-12-5-3-2-4-11(12)22-6-8-23(9-7-22)16-13-14(17)20-21-15(13)18-10-19-16/h2-5,10H,6-9H2,1H3,(H,18,19,20,21) |
InChIKey | CQXAPCMYRSTDGK-UHFFFAOYSA-N |
SMILES | COC1=CC=CC=C1N2CCN(CC2)C3=NC=NC4=NNC(=C43)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |