For research use only. Not for therapeutic Use.
(S)-UFR2709 hydrochloride（Cat No.:I044680）is a selective, competitive antagonist of the nicotinic acetylcholine receptor (nAChR), particularly targeting the α4β2 subtype, which is widely implicated in cognitive function, addiction, and neurodegenerative diseases. By inhibiting nAChRs, (S)-UFR2709 modulates cholinergic neurotransmission, offering potential therapeutic benefits in conditions like nicotine dependence, Alzheimer’s disease, and schizophrenia. The (S)-enantiomer displays greater potency and receptor selectivity than its counterpart, contributing to its pharmacological relevance. As a hydrochloride salt, it exhibits improved solubility and stability, making it suitable for both in vitro and in vivo pharmacological studies.
| CAS Number | 2934318-93-9 |
| Synonyms | [(2S)-1-methylpyrrolidin-2-yl]methyl benzoate;hydrochloride |
| Molecular Formula | C13H18ClNO2 |
| Purity | ≥95% |
| IUPAC Name | [(2S)-1-methylpyrrolidin-2-yl]methyl benzoate;hydrochloride |
| InChI | InChI=1S/C13H17NO2.ClH/c1-14-9-5-8-12(14)10-16-13(15)11-6-3-2-4-7-11;/h2-4,6-7,12H,5,8-10H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | IJJHQEXZNVTJHI-YDALLXLXSA-N |
| SMILES | CN1CCC[C@H]1COC(=O)C2=CC=CC=C2.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
