s-Triazine-1,3,5-triethanol(Cat No.:R052033) is a derivative of triazine, featuring three hydroxyl (ethanol) groups attached to each carbon of the triazine ring. This symmetrical structure enhances its functionality as a versatile chemical intermediate. The hydroxyl groups make it more hydrophilic and reactive, suitable for various chemical synthesis applications, particularly in creating crosslinking agents, resins, and polymers. Its unique binding capabilities and thermal stability are utilized in the production of coatings, adhesives, and textiles. Additionally, s-triazine-1,3,5-triethanol serves as a precursor in the manufacture of agricultural chemicals and pharmaceuticals, leveraging its tri-functional nature for complex molecular constructions.
Catalog Number | R052033 |
CAS Number | 4719-04-4 |
Synonyms | 1,3,5-Tris(2-hydroxyethyl)-1,3,5-triazacyclohexane; 1,3,5-Tris(2-hydroxyethyl)hexahydro-1,3,5-triazine; 1,3,5-Tris(2-hydroxyethyl)hexahydro-s-triazine; Actane; Acticide GR; Bactraclean; Bioban GK; Busan 1060; Busan 1506; Cobate C; ETA 75; Grotan B; G |
Molecular Formula | C9H21N3O3 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 2-[3,5-bis(2-hydroxyethyl)-1,3,5-triazinan-1-yl]ethanol |
InChI | InChI=1S/C9H21N3O3/c13-4-1-10-7-11(2-5-14)9-12(8-10)3-6-15/h13-15H,1-9H2 |
InChIKey | HUHGPYXAVBJSJV-UHFFFAOYSA-N |
SMILES | C1N(CN(CN1CCO)CCO)CCO |