For research use only. Not for therapeutic Use.
(S)-(-)-Tetrahydroberberine (Cat No.:R016984) is a reduced, optically active form of berberine, an isoquinoline alkaloid derived from various medicinal plants. It exhibits a range of pharmacological effects, including antioxidant, anti-inflammatory, cardioprotective, and neuroactive properties. (S)-(-)-Tetrahydroberberine is known to modulate dopamine receptors, particularly D1 and D2, making it valuable in neurological and psychiatric research related to depression, addiction, and Parkinson’s disease. Its improved bioavailability and reduced toxicity compared to berberine enhance its therapeutic potential. Researchers study it for applications in cardiovascular, metabolic, and neurodegenerative disease models.
| CAS Number | 5096-57-1 |
| Synonyms | (1S)-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
| Molecular Formula | C20H21NO4 |
| Purity | ≥95% |
| IUPAC Name | (1S)-16,17-dimethoxy-5,7-dioxa-13-azapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-2,4(8),9,15(20),16,18-hexaene |
| InChI | InChI=1S/C20H21NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-4,8-9,16H,5-7,10-11H2,1-2H3/t16-/m0/s1 |
| InChIKey | VZTUIEROBZXUFA-INIZCTEOSA-N |
| SMILES | COC1=C(C2=C(C[C@H]3C4=CC5=C(C=C4CCN3C2)OCO5)C=C1)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
