For research use only. Not for therapeutic Use.
(S)-Pulegone(CAT: R028243) is a naturally occurring compound found in various plants, particularly in essential oils. It is primarily associated with its distinctive minty aroma and flavor. In organic chemistry, (S)-pulegone serves as a chiral building block for the synthesis of other compounds, thanks to its asymmetric structure.
CAS Number | 3391-90-0 |
Synonyms | (S)-5-Methyl-2-(1-methylethylidene)-cyclohexanone; (S)-(-)-p-Menth-4(8)-en-3-one; (-)-Pulegone; (1S)-Pulegone; (S)-(-)-Pulegone; (S)-Pulegone; l-Pulegone |
Molecular Formula | C10H16O |
Purity | ≥95% |
Storage | Store at +4°C |
IUPAC Name | (5S)-5-methyl-2-propan-2-ylidenecyclohexan-1-one |
InChI | InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3/t8-/m0/s1 |
InChIKey | NZGWDASTMWDZIW-QMMMGPOBSA-N |
SMILES | CC1CCC(=C(C)C)C(=O)C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |