For research use only. Not for therapeutic Use.
(S)-Nicardipine(CAT:I017406) is the enantiomer of nicardipine, a dihydropyridine calcium channel blocker that selectively targets L-type voltage-gated calcium channels. As the pharmacologically active isomer, (S)-Nicardipine exhibits stronger vasodilatory and antihypertensive effects compared to the (R)-form, making it a critical reference compound for stereoselective pharmacology studies. It relaxes vascular smooth muscle, improves coronary blood flow, and reduces blood pressure by inhibiting calcium influx. (S)-Nicardipine is widely used in cardiovascular research, enantiomeric profiling, and drug development, offering valuable insights into calcium signaling, chiral drug activity, and therapeutic potential in hypertension and angina.
| CAS Number | 76093-36-2 |
| Synonyms | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Formula | C26H29N3O6 |
| Purity | ≥95% |
| IUPAC Name | 5-O-[2-[benzyl(methyl)amino]ethyl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChI | InChI=1S/C26H29N3O6/c1-17-22(25(30)34-4)24(20-11-8-12-21(15-20)29(32)33)23(18(2)27-17)26(31)35-14-13-28(3)16-19-9-6-5-7-10-19/h5-12,15,24,27H,13-14,16H2,1-4H3/t24-/m0/s1 |
| InChIKey | ZBBHBTPTTSWHBA-DEOSSOPVSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OCCN(C)CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
