For research use only. Not for therapeutic Use.
S-Methyl-cefmetazole is a sulfur-containing cephalosporin antibiotic derivative known for its potent antibacterial properties. It is utilized in pharmaceutical research to study its efficacy against a broad spectrum of bacterial infections. This compound is significant in developing advanced antibiotics, helping to combat resistant strains and improving therapeutic outcomes in clinical settings.
| CAS Number | 68576-47-6 |
| Synonyms | (6R-cis)-7-[[[(Cyanomethyl)thio]acetyl]amino]-3-[[(1-methyl-1H-tetrazol-5-yl)thio]methyl]-7-(methylthio)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Molecular Formula | C15H17N7O4S4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (6R,7S)-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-7-methylsulfanyl-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChI | InChI=1S/C15H17N7O4S4/c1-21-14(18-19-20-21)30-6-8-5-29-13-15(27-2,17-9(23)7-28-4-3-16)12(26)22(13)10(8)11(24)25/h13H,4-7H2,1-2H3,(H,17,23)(H,24,25)/t13-,15+/m1/s1 |
| InChIKey | XWKWCPOCBYWASE-HIFRSBDPSA-N |
| SMILES | CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)(NC(=O)CSCC#N)SC)SC2)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |