(S)-Methyl 2-((tert-butoxycarbonyl)amino)-2-(4-hydroxyphenyl)acetate - CAS 225517-15-7

(S)-Methyl 2-((start-butoxy carbonyl)amino)-2-(4-hydroxyphenyl)acetate(Cat No.:L008783), is a chemical compound used in pharmaceutical research and development. It belongs to the class of compounds known as amino acid derivatives and is characterized by a chiral center, denoted by the (S)-configuration. This compound is often employed in the synthesis of complex molecules and pharmaceutical intermediates.

Catalog Number: L008783

CAS Number: 225517-15-7

Molecular Formula: C14H19NO5

Molecular Weight:281.30

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C14H19NO5
Molecular Weight281.30
Purity≥95%

Computed Descriptor

IUPAC Namemethyl (2S)-2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate
InChIInChI=1S/C14H19NO5/c1-14(2,3)20-13(18)15-11(12(17)19-4)9-5-7-10(16)8-6-9/h5-8,11,16H,1-4H3,(H,15,18)/t11-/m0/s1
InChIKeyHGJGPDQDXKDZTQ-NSHDSACASA-N
SMILESCC(C)(C)OC(=O)NC(C1=CC=C(C=C1)O)C(=O)OC