Home
>
Chemical Reagents>Organic Building Blocks> (S)-Methyl 2-((S)-2-(((benzyloxy)carbonyl)amino)-3-methylbutanamido)-3-(4-hydroxyphenyl)propanoate
For research use only. Not for therapeutic Use.
(S)-Methyl 2-((S)-2-(((benzyloxy)carbonyl)amino)-3-methylbutanamido)-3-(4-hydroxyphenyl)propanoate(Cat No.:L006905), is a complex organic compound. Its molecular structure includes a chiral amide group with a benzyloxy carbonyl protecting group, a methylbutanamido group, and a hydroxyphenylpropanoate group. This compound is valuable in organic synthesis, particularly in the development of pharmaceuticals and bioactive molecules. Its specific arrangement of functional groups enables researchers to explore structure-activity relationships, design new compounds, and study biological interactions.
| CAS Number | 15149-72-1 |
| Molecular Formula | C23H28N2O6 |
| Purity | ≥95% |
| IUPAC Name | methyl (2S)-3-(4-hydroxyphenyl)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate |
| InChI | InChI=1S/C23H28N2O6/c1-15(2)20(25-23(29)31-14-17-7-5-4-6-8-17)21(27)24-19(22(28)30-3)13-16-9-11-18(26)12-10-16/h4-12,15,19-20,26H,13-14H2,1-3H3,(H,24,27)(H,25,29)/t19-,20-/m0/s1 |
| InChIKey | SWPXBDJUGLEKES-PMACEKPBSA-N |
| SMILES | CC(C)C(C(=O)NC(CC1=CC=C(C=C1)O)C(=O)OC)NC(=O)OCC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |