For research use only. Not for therapeutic Use.
(S)-(+)-Ibuprofen-d3 is a deuterated form of the (S)-(+)-enantiomer of ibuprofen, with three hydrogen atoms replaced by deuterium. This isotopically labeled compound is crucial in pharmacokinetic and metabolic studies, allowing for precise tracking and analysis without altering the drug’s therapeutic activity. (S)-(+)-Ibuprofen is the active enantiomer responsible for the anti-inflammatory, analgesic, and antipyretic effects of ibuprofen, commonly used to treat pain, inflammation, and fever. In pharmaceutical research, (S)-(+)-Ibuprofen-d3 helps in studying drug metabolism, interaction, and absorption in the body.
| CAS Number | 1329643-44-8 |
| Synonyms | (αS)-α-(Methyl-d3)-4-(2-methylpropyl)benzeneacetic Acid; (+)-Ibuprofen-d3; (S)-2-(4-Isobutylphenyl)propanoic Acid-d3; (S)-Ibuprofen-d3; S-(+)-p-Isobutylhydratropic Acid-d3; |
| Molecular Formula | C13H18O2 |
| Purity | ≥95% |
| Target | COX |
| Storage | -20°C |
| IUPAC Name | (2S)-3,3,3-trideuterio-2-[4-(2-methylpropyl)phenyl]propanoic acid |
| InChI | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m0/s1/i3D3 |
| InChIKey | HEFNNWSXXWATRW-PCXQMPHHSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](C1=CC=C(C=C1)CC(C)C)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |