(S)-Benzyl 2-amino-3-(benzyloxy)propanoate hydrochloride - CAS 63024-01-1
(S)-Benzyl 2-amino-3-(benzyloxy)propanoate hydrochloride (CAT: L000227) is a chiral compound widely used in the pharmaceutical field. It acts as a key intermediate in the synthesis of enantiopure compounds. This compound’s primary role is in asymmetric synthesis, where it helps create optically active building blocks essential for drug development. In pharmaceutical and organic chemistry, it serves as a valuable tool for generating stereospecific molecules.
Catalog Number: L000227
CAS Number: 63024-01-1
Molecular Formula: C17H20ClNO3
Molecular Weight:321.8
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
| Molecular Formula: | C17H20ClNO3 |
|---|---|
| Molecular Weight | 321.8 |
| Purity | ≥95% |
Computed Descriptor
| IUPAC Name | benzyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride |
|---|---|
| InChI | InChI=1S/C17H19NO3.ClH/c18-16(13-20-11-14-7-3-1-4-8-14)17(19)21-12-15-9-5-2-6-10-15;/h1-10,16H,11-13,18H2;1H/t16-;/m0./s1 |
| InChIKey | BGAVLJMLSSCOSD-NTISSMGPSA-N |