(S)-Benzyl 2-amino-3-(benzyloxy)propanoate hydrochloride (CAT: L000227) is a chiral compound widely used in the pharmaceutical field. It acts as a key intermediate in the synthesis of enantiopure compounds. This compound’s primary role is in asymmetric synthesis, where it helps create optically active building blocks essential for drug development. In pharmaceutical and organic chemistry, it serves as a valuable tool for generating stereospecific molecules.
| Catalog Number | L000227 |
| CAS Number | 63024-01-1 |
| Molecular Formula | C17H20ClNO3 |
| Purity | ≥95% |
| IUPAC Name | benzyl (2S)-2-amino-3-phenylmethoxypropanoate;hydrochloride |
| InChI | InChI=1S/C17H19NO3.ClH/c18-16(13-20-11-14-7-3-1-4-8-14)17(19)21-12-15-9-5-2-6-10-15;/h1-10,16H,11-13,18H2;1H/t16-;/m0./s1 |
| InChIKey | BGAVLJMLSSCOSD-NTISSMGPSA-N |
