For research use only. Not for therapeutic Use.
(S)-AMPA (Cat No.:R017034) is a selective agonist for the AMPA receptor, a subtype of ionotropic glutamate receptors in the brain. It is a potent excitatory neurotransmitter that mimics the action of glutamate, playing a crucial role in synaptic transmission, learning, and memory processes. (S)-AMPA is commonly used in scientific research to study the function of AMPA receptors and their involvement in neuroplasticity and neurodegenerative diseases. Its enantiomeric form, (S)-AMPA, is preferred due to its higher potency and selectivity compared to the (R)-form.
CAS Number | 83643-88-3 |
Synonyms | (S)-α-Amino-3-hydroxy-5-methylisoxazole-4-propionic Acid; L-AMPA |
Molecular Formula | C7H10N2O4 |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | Soluble to 100 mM in sterile water |
Storage | Store at RT |
IUPAC Name | (2S)-2-amino-3-(5-methyl-3-oxo-1,2-oxazol-4-yl)propanoic acid |
InChI | InChI=1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12)/t5-/m0/s1 |
InChIKey | UUDAMDVQRQNNHZ-YFKPBYRVSA-N |
SMILES | CC1=C(C(=O)NO1)C[C@@H](C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |