For research use only. Not for therapeutic Use.
(S)-(-)-6-Methoxy-2-aminotetralin(CAT: M041595) is a chiral aminotetralin derivative featuring a methoxy group at the 6-position and an (S)-enantiomeric configuration. This bicyclic aromatic amine is structurally related to bioactive compounds that interact with neurotransmitter systems, particularly dopaminergic and serotonergic pathways. It is widely used in neuropharmacology research to study receptor selectivity, signal transduction, and structure–activity relationships. The compound’s stereochemistry plays a critical role in its biological interactions, making it a valuable tool for enantioselective binding and functional assays. Its applications span medicinal chemistry, behavioral neuroscience, and the development of therapeutics targeting central nervous system disorders.
| CAS Number | 177017-69-5 |
| Molecular Formula | C11H15NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2S)-6-methoxy-1,2,3,4-tetrahydronaphthalen-2-amine |
| InChI | InChI=1S/C11H15NO/c1-13-11-5-3-8-6-10(12)4-2-9(8)7-11/h3,5,7,10H,2,4,6,12H2,1H3/t10-/m0/s1 |
| InChIKey | WASIYUSITZITPW-JTQLQIEISA-N |
| SMILES | COC1=CC2=C(CC(CC2)N)C=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
