For research use only. Not for therapeutic Use.
(S)-4-Methyl-2-(methylamino)pentanoic acid hydrochloride(Cat No.:I042995)is a chiral compound often used in biochemical research and synthetic chemistry. It features a methylamino group attached to a pentanoic acid backbone, with a methyl group at the 4-position of the carbon chain. This compound is valuable in studying amino acid metabolism, as it may serve as a precursor or intermediate in the synthesis of biologically active molecules. It is particularly useful in the development of compounds targeting neurological pathways, where such structural motifs are involved in modulating neurotransmitter systems and enzyme activity.
CAS Number | 66866-69-1 |
Synonyms | (2S)-4-methyl-2-(methylamino)pentanoic acid;hydrochloride |
Molecular Formula | C7H16ClNO2 |
Purity | ≥95% |
IUPAC Name | (2S)-4-methyl-2-(methylamino)pentanoic acid;hydrochloride |
InChI | InChI=1S/C7H15NO2.ClH/c1-5(2)4-6(8-3)7(9)10;/h5-6,8H,4H2,1-3H3,(H,9,10);1H/t6-;/m0./s1 |
InChIKey | QYFWCUVWMMTENJ-RGMNGODLSA-N |
SMILES | CC(C)C[C@@H](C(=O)O)NC.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |