Home
>
Chemical Reagents>Organic Building Blocks>
>
(S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethan-1-amine hydrochloride
(S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethan-1-amine hydrochloride (Cat.No:L003654) is a significant chiral amine compound with notable applications in pharmaceutical research. Its unique structure, featuring fluorinated and phenyl groups, confers valuable pharmacological properties. This compound is employed as a key intermediate in the synthesis of various pharmaceutical agents, demonstrating its pivotal role in drug development processes.
Catalog Number | L003654 |
CAS Number | 1391504-94-1 |
Molecular Formula | C8H8ClF4N |
Purity | 95% |
IUPAC Name | (1S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride |
InChI | InChI=1S/C8H7F4N.ClH/c9-6-4-2-1-3-5(6)7(13)8(10,11)12;/h1-4,7H,13H2;1H/t7-;/m0./s1 |
InChIKey | BOLBLATUWRKBDZ-FJXQXJEOSA-N |
SMILES | C1=CC=C(C(=C1)[C@@H](C(F)(F)F)N)F.Cl |