For research use only. Not for therapeutic Use.
(S)-2-Amino-3-(4-bromophenyl)propanoic acid（Cat No.:I043108）is an amino acid derivative with a chiral center at the α-carbon, making it a useful building block in organic synthesis and peptide chemistry. The compound features a 4-bromophenyl group attached to the β-carbon, providing unique reactivity and electronic properties. It is often employed in the synthesis of bioactive molecules and pharmaceutical intermediates, particularly in studies related to neurotransmitter systems, such as glutamate receptors. Its structural properties also make it a valuable tool for exploring structure-activity relationships in drug design.
| CAS Number | 24250-84-8 |
| Synonyms | (2S)-2-amino-3-(4-bromophenyl)propanoic acid |
| Molecular Formula | C9H10BrNO2 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-3-(4-bromophenyl)propanoic acid |
| InChI | InChI=1S/C9H10BrNO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | PEMUHKUIQHFMTH-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
