For research use only. Not for therapeutic Use.
(S)-2-Amino-2-(o-tolyl)ethan-1-ol hydrochloride (Cat.No:L003944) is a crucial chiral compound in pharmaceutical research. Its specific enantiomeric form, along with the o-tolyl group, imparts unique biological activity. This compound serves as a key intermediate in the synthesis of specialized pharmaceuticals, particularly in the development of novel therapeutic agents.
CAS Number | 1917283-73-8 |
Molecular Formula | C9H14ClNO |
Purity | ≥95% |
IUPAC Name | (2S)-2-amino-2-(2-methylphenyl)ethanol;hydrochloride |
InChI | InChI=1S/C9H13NO.ClH/c1-7-4-2-3-5-8(7)9(10)6-11;/h2-5,9,11H,6,10H2,1H3;1H/t9-;/m1./s1 |
InChIKey | XRCVRMHELDJLFA-SBSPUUFOSA-N |
SMILES | CC1=CC=CC=C1[C@@H](CO)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |