Home
>
Chemical Reagents>Organic Building Blocks> (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-(3-fluorophenyl)propanoic acid
For research use only. Not for therapeutic Use.
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-(3-fluorophenyl)propanoic acid (CAT: L000250) is a significant compound in pharmaceutical and organic chemistry. This chemical is crucial for drug development, particularly in the synthesis of pharmaceutical agents. It acts as a key structural component in medicinal chemistry, enabling the creation of novel pharmaceutical compounds.
| CAS Number | 1820567-10-9 |
| Molecular Formula | C25H22FNO4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(3-fluorophenyl)propanoic acid |
| InChI | InChI=1S/C25H22FNO4/c1-27(23(24(28)29)14-16-7-6-8-17(26)13-16)25(30)31-15-22-20-11-4-2-9-18(20)19-10-3-5-12-21(19)22/h2-13,22-23H,14-15H2,1H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | IEEAUJSAPYTPBS-QHCPKHFHSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |