(S)-1-(p-Tolyl)butan-1-amine (Cat.No:L003991) is a significant chiral compound in pharmaceutical research. Its enantiopure form exhibits unique pharmacological properties. This amine derivative serves as a key intermediate in the synthesis of bioactive molecules, particularly in the development of pharmaceutical agents.
| Catalog Number | L003991 |
| CAS Number | 344794-57-6 |
| Molecular Formula | C11H17N |
| Purity | 95% |
| IUPAC Name | (1S)-1-(4-methylphenyl)butan-1-amine |
| InChI | InChI=1S/C11H17N/c1-3-4-11(12)10-7-5-9(2)6-8-10/h5-8,11H,3-4,12H2,1-2H3/t11-/m0/s1 |
| InChIKey | KONSGDUJYXXYMT-NSHDSACASA-N |
| SMILES | CCC[C@@H](C1=CC=C(C=C1)C)N |
