For research use only. Not for therapeutic Use.
(S)-1-(3-Fluorophenyl)-2-methoxyethanamine hydrochloride (Cat.No:L003857) is a significant chiral compound in pharmaceutical research. Its enantiomeric purity is crucial in drug development, particularly in the creation of selective pharmaceutical agents. This compound’s unique structure and stereochemistry make it a valuable building block in the synthesis of bioactive molecules.
CAS Number | 2442565-25-3 |
Molecular Formula | C9H13ClFNO |
Purity | ≥95% |
IUPAC Name | (1S)-1-(3-fluorophenyl)-2-methoxyethanamine;hydrochloride |
InChI | InChI=1S/C9H12FNO.ClH/c1-12-6-9(11)7-3-2-4-8(10)5-7;/h2-5,9H,6,11H2,1H3;1H/t9-;/m1./s1 |
InChIKey | QOSVPONCJXJVGP-SBSPUUFOSA-N |
SMILES | COC[C@H](C1=CC(=CC=C1)F)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |