For research use only. Not for therapeutic Use.
RY796（Cat No.:I009245）is a potent and selective small-molecule inhibitor of casein kinase 2 (CK2), a serine/threonine kinase involved in regulating cell proliferation, apoptosis, and DNA repair. By blocking CK2 activity, RY796 disrupts oncogenic signaling pathways, leading to impaired tumor cell survival and growth. This compound is a valuable tool for investigating CK2-dependent mechanisms in cancer biology and other cellular processes. Its specificity and strong activity make it useful for exploring therapeutic strategies targeting dysregulated kinase signaling in oncology and related disease research.
| CAS Number | 1393441-53-6 |
| Synonyms | 2-(dimethylamino)-5-(2-methylpropanoylamino)-N-[(1R)-1-phenylethyl]benzamide |
| Molecular Formula | C21H27N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-(dimethylamino)-5-(2-methylpropanoylamino)-N-[(1R)-1-phenylethyl]benzamide |
| InChI | InChI=1S/C21H27N3O2/c1-14(2)20(25)23-17-11-12-19(24(4)5)18(13-17)21(26)22-15(3)16-9-7-6-8-10-16/h6-15H,1-5H3,(H,22,26)(H,23,25)/t15-/m1/s1 |
| InChIKey | LDXZFQWWXMRMAS-OAHLLOKOSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)C2=C(C=CC(=C2)NC(=O)C(C)C)N(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
