For research use only. Not for therapeutic Use.
Rutarin(Cat No.:I035820)is a natural compound extracted from the plant species Rutaceae, known for its potential pharmacological properties. It has been studied for its antioxidant, anti-inflammatory, and anticancer activities. Rutarin works by modulating various molecular pathways involved in oxidative stress and inflammation, making it a potential candidate for the treatment of chronic diseases such as cardiovascular disorders, neurodegenerative diseases, and cancer. Preclinical studies suggest that rutarin may offer therapeutic benefits by reducing inflammation, protecting cells from oxidative damage, and inhibiting the growth of cancerous cells, although further clinical research is needed.
CAS Number | 20320-81-4 |
Synonyms | 2-(2-hydroxypropan-2-yl)-9-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrofuro[3,2-g]chromen-7-one |
Molecular Formula | C20H24O10 |
Purity | ≥95% |
IUPAC Name | (2S)-2-(2-hydroxypropan-2-yl)-9-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrofuro[3,2-g]chromen-7-one |
InChI | InChI=1S/C20H24O10/c1-20(2,26)11-6-9-5-8-3-4-12(22)29-16(8)18(17(9)28-11)30-19-15(25)14(24)13(23)10(7-21)27-19/h3-5,10-11,13-15,19,21,23-26H,6-7H2,1-2H3/t10-,11+,13-,14+,15-,19+/m1/s1 |
InChIKey | JWWFVRMFYKPZNE-VVIWCBLHSA-N |
SMILES | CC(C)([C@@H]1CC2=C(O1)C(=C3C(=C2)C=CC(=O)O3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |