For research use only. Not for therapeutic Use.
Rutaevin(CAT:R066306) is a limonoid triterpene compound isolated from plants of the Rutaceae family, particularly Dictamnus and Ruta species. Structurally, it features the highly oxygenated tetranortriterpenoid skeleton typical of limonoids, contributing to its notable bitterness and biological activity. Studies indicate that rutaevin exhibits antimicrobial, anti-inflammatory, and cytotoxic effects, making it of interest in natural product and pharmacological research. Like other limonoids, it may interact with cellular enzymes and signaling pathways involved in oxidative stress and immune modulation. Rutaevin also serves as a valuable chemotaxonomic marker in Rutaceae species and is explored as a lead compound for drug discovery.
| CAS Number | 33237-37-5 |
| Synonyms | (1R,2R,7S,10S,12R,13S,14R,16S,19S,20S)-19-(furan-3-yl)-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
| Molecular Formula | C26H30O9 |
| Purity | ≥95% |
| IUPAC Name | (1R,2R,7S,10S,12R,13S,14R,16S,19S,20S)-19-(furan-3-yl)-12-hydroxy-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
| InChI | InChI=1S/C26H30O9/c1-22(2)17-16(28)18(29)24(4)13(25(17)11-32-15(27)9-14(25)34-22)5-7-23(3)19(12-6-8-31-10-12)33-21(30)20-26(23,24)35-20/h6,8,10,13-14,17-20,29H,5,7,9,11H2,1-4H3/t13-,14-,17+,18-,19-,20+,23-,24-,25-,26+/m0/s1 |
| InChIKey | YZMKFMIZNSOPSN-ZIQVUAKTSA-N |
| SMILES | CC1(C2C(=O)C(C3(C(C24COC(=O)CC4O1)CCC5(C36C(O6)C(=O)OC5C7=COC=C7)C)C)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
