For research use only. Not for therapeutic Use.
Rubropunctatin（Cat No.:I035802）is an orange-red azaphilone pigment produced by Monascus species, especially Monascus purpureus, during fermentation. It is one of the key natural colorants in red yeast rice and exhibits both coloring and bioactive properties. Structurally, rubropunctatin is a polyketide compound with a lactone ring, contributing to its stability and biological activity. It has shown antimicrobial, antioxidant, and cholesterol-lowering effects, making it valuable in food and nutraceutical applications. Additionally, rubropunctatin serves as a precursor to monacolin K (lovastatin) derivatives, further enhancing its relevance in cardiovascular health research.
| CAS Number | 514-67-0 |
| Synonyms | (9aR)-3-hexanoyl-9a-methyl-6-[(E)-prop-1-enyl]furo[3,2-g]isochromene-2,9-dione |
| Molecular Formula | C21H22O5 |
| Purity | ≥95% |
| IUPAC Name | (9aR)-3-hexanoyl-9a-methyl-6-[(E)-prop-1-enyl]furo[3,2-g]isochromene-2,9-dione |
| InChI | InChI=1S/C21H22O5/c1-4-6-7-9-17(22)18-16-11-13-10-14(8-5-2)25-12-15(13)19(23)21(16,3)26-20(18)24/h5,8,10-12H,4,6-7,9H2,1-3H3/b8-5+/t21-/m1/s1 |
| InChIKey | SULYDLFVUNXAMP-WKOQKXSESA-N |
| SMILES | CCCCCC(=O)C1=C2C=C3C=C(OC=C3C(=O)[C@@]2(OC1=O)C)/C=C/C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
