For research use only. Not for therapeutic Use.
Rubidium dichromate(Cat No.:M061727), with the chemical formula Rb2Cr2O7, is an inorganic compound that combines rubidium and chromium in a dichromate anion. This compound is known for its vivid orange-red crystals that exhibit properties typical of other dichromate salts, such as strong oxidizing capabilities. Rubidium dichromate is used primarily in chemical synthesis and analytical chemistry. Due to the presence of the chromium (VI) ion, it is highly toxic and carcinogenic, requiring careful handling and disposal. In laboratories, it may be used for oxidizing organic compounds and in experiments requiring a strong oxidant.
| CAS Number | 13446-73-6 |
| Molecular Formula | Cr2O7Rb2 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | oxido-(oxido(dioxo)chromio)oxy-dioxochromium;rubidium(1+) |
| InChI | InChI=1S/2Cr.7O.2Rb/q;;;;;;;2*-1;2*+1 |
| InChIKey | XCKVUBJBAQQSCF-UHFFFAOYSA-N |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[Rb+].[Rb+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |